C20H50N8O4Si2 — CID 123500215
2-[2-[3-[3-[3-[2-(diaminomethylideneamino)ethylamino]propyl-ethoxy-methylsilyl]oxypropoxy-methoxy-methylsilyl]propylamino]ethyl]guanidine (PubChem CID 123500215) has the molecular formula C20H50N8O4Si2 and a molecular weight of 522.84 g/mol. Its IUPAC name is 2-[2-[3-[3-[3-[2-(diaminomethylideneamino)ethylamino]propyl-ethoxy-methylsilyl]oxypropoxy-methoxy-methylsilyl]propylamino]ethyl]guanidine.
| Compound Name | 2-[2-[3-[3-[3-[2-(diaminomethylideneamino)ethylamino]propyl-ethoxy-methylsilyl]oxypropoxy-methoxy-methylsilyl]propylamino]ethyl]guanidine |
|---|---|
| PubChem CID | 123500215 |
| Molecular Formula | C20H50N8O4Si2 |
| Molecular Weight | 522.84 g/mol |
| Exact Mass | 522.35 |
| IUPAC Name | 2-[2-[3-[3-[3-[2-(diaminomethylideneamino)ethylamino]propyl-ethoxy-methylsilyl]oxypropoxy-methoxy-methylsilyl]propylamino]ethyl]guanidine |
| SMILES | CCO[Si](C)(CCCNCCN=C(N)N)OCCCO[Si](C)(CCCNCCN=C(N)N)OC |
| InChI | InChI=1S/C20H50N8O4Si2/c1-5-30-34(4,18-7-10-26-12-14-28-20(23)24)32-16-8-15-31-33(3,29-2)17-6-9-25-11-13-27-19(21)22/h25-26H,5-18H2,1-4H3,(H4,21,22,27)(H4,23,24,28) |
| InChIKey | PBZAYINGRMCAIJ-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 189.78 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.84 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|