C25H58N4O5Si2 — CID 123955370
N'-[6-[dimethoxy(methyl)silyl]hexyl]ethanimidamide;N'-(6-triethoxysilylhexyl)ethanimidamide (PubChem CID 123955370) has the molecular formula C25H58N4O5Si2 and a molecular weight of 550.93 g/mol. Its IUPAC name is N'-[6-[dimethoxy(methyl)silyl]hexyl]ethanimidamide;N'-(6-triethoxysilylhexyl)ethanimidamide.
| Compound Name | N'-[6-[dimethoxy(methyl)silyl]hexyl]ethanimidamide;N'-(6-triethoxysilylhexyl)ethanimidamide |
|---|---|
| PubChem CID | 123955370 |
| Molecular Formula | C25H58N4O5Si2 |
| Molecular Weight | 550.93 g/mol |
| Exact Mass | 550.39 |
| IUPAC Name | N'-[6-[dimethoxy(methyl)silyl]hexyl]ethanimidamide;N'-(6-triethoxysilylhexyl)ethanimidamide |
| SMILES | CCO[Si](CCCCCC/N=C(\C)N)(OCC)OCC.CO[Si](C)(CCCCCC/N=C(\C)N)OC |
| InChI | InChI=1S/C14H32N2O3Si.C11H26N2O2Si/c1-5-17-20(18-6-2,19-7-3)13-11-9-8-10-12-16-14(4)15;1-11(12)13-9-7-5-6-8-10-16(4,14-2)15-3/h5-13H2,1-4H3,(H2,15,16);5-10H2,1-4H3,(H2,12,13) |
| InChIKey | NQMIGZUBTFECCG-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 122.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.93 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|