About 3-[dimethoxy(methyl)silyl]propane-1-thiol;triethoxy(propyl)silane
3-[dimethoxy(methyl)silyl]propane-1-thiol;triethoxy(propyl)silane (PubChem CID 88614402) has the molecular formula C15H38O5SSi2
and a molecular weight of 386.70 g/mol. Its IUPAC name is 3-[dimethoxy(methyl)silyl]propane-1-thiol;triethoxy(propyl)silane.
Molecular Properties
| Compound Name | 3-[dimethoxy(methyl)silyl]propane-1-thiol;triethoxy(propyl)silane |
| PubChem CID | 88614402 |
| Molecular Formula | C15H38O5SSi2 |
| Molecular Weight | 386.70 g/mol |
| Exact Mass | 386.20 |
| IUPAC Name | 3-[dimethoxy(methyl)silyl]propane-1-thiol;triethoxy(propyl)silane |
| SMILES | CCC[Si](OCC)(OCC)OCC.CO[Si](C)(CCCS)OC |
| InChI | InChI=1S/C9H22O3Si.C6H16O2SSi/c1-5-9-13(10-6-2,11-7-3)12-8-4;1-7-10(3,8-2)6-4-5-9/h5-9H2,1-4H3;9H,4-6H2,1-3H3 |
| InChIKey | HSWXLNDEEACMCF-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 46.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 386.70 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 3-[dimethoxy(methyl)silyl]propane-1-thiol;triethoxy(propyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[dimethoxy(methyl)silyl]propane-1-thiol;triethoxy(propyl)silane?
The IUPAC name of 3-[dimethoxy(methyl)silyl]propane-1-thiol;triethoxy(propyl)silane (CID 88614402) is 3-[dimethoxy(methyl)silyl]propane-1-thiol;triethoxy(propyl)silane.
What is the SMILES notation for 3-[dimethoxy(methyl)silyl]propane-1-thiol;triethoxy(propyl)silane?
The canonical SMILES for 3-[dimethoxy(methyl)silyl]propane-1-thiol;triethoxy(propyl)silane is CCC[Si](OCC)(OCC)OCC.CO[Si](C)(CCCS)OC.
What is the InChIKey of 3-[dimethoxy(methyl)silyl]propane-1-thiol;triethoxy(propyl)silane?
The InChIKey is HSWXLNDEEACMCF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H22O3Si.C6H16O2SSi/c1-5-9-13(10-6-2,11-7-3)12-8-4;1-7-10(3,8-2)6-4-5-9/h5-9H2,1-4H3;9H,4-6H2,1-3H3.
What are the key properties of 3-[dimethoxy(methyl)silyl]propane-1-thiol;triethoxy(propyl)silane?
3-[dimethoxy(methyl)silyl]propane-1-thiol;triethoxy(propyl)silane has a molecular weight of 386.70 g/mol, XLogP of 4.12, 13 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[dimethoxy(methyl)silyl]propane-1-thiol;triethoxy(propyl)silane is sourced from PubChem (CID 88614402), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).