About butyl(triethoxy)silane;trimethoxy(propyl)silane
butyl(triethoxy)silane;trimethoxy(propyl)silane (PubChem CID 158050354) has the molecular formula C16H40O6Si2
and a molecular weight of 384.66 g/mol. Its IUPAC name is butyl(triethoxy)silane;trimethoxy(propyl)silane.
Molecular Properties
| Compound Name | butyl(triethoxy)silane;trimethoxy(propyl)silane |
| PubChem CID | 158050354 |
| Molecular Formula | C16H40O6Si2 |
| Molecular Weight | 384.66 g/mol |
| Exact Mass | 384.24 |
| IUPAC Name | butyl(triethoxy)silane;trimethoxy(propyl)silane |
| SMILES | CCCC[Si](OCC)(OCC)OCC.CCC[Si](OC)(OC)OC |
| InChI | InChI=1S/C10H24O3Si.C6H16O3Si/c1-5-9-10-14(11-6-2,12-7-3)13-8-4;1-5-6-10(7-2,8-3)9-4/h5-10H2,1-4H3;5-6H2,1-4H3 |
| InChIKey | FJKDYKNQNJQEFZ-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 384.66 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze butyl(triethoxy)silane;trimethoxy(propyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butyl(triethoxy)silane;trimethoxy(propyl)silane?
The IUPAC name of butyl(triethoxy)silane;trimethoxy(propyl)silane (CID 158050354) is butyl(triethoxy)silane;trimethoxy(propyl)silane.
What is the SMILES notation for butyl(triethoxy)silane;trimethoxy(propyl)silane?
The canonical SMILES for butyl(triethoxy)silane;trimethoxy(propyl)silane is CCCC[Si](OCC)(OCC)OCC.CCC[Si](OC)(OC)OC.
What is the InChIKey of butyl(triethoxy)silane;trimethoxy(propyl)silane?
The InChIKey is FJKDYKNQNJQEFZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H24O3Si.C6H16O3Si/c1-5-9-10-14(11-6-2,12-7-3)13-8-4;1-5-6-10(7-2,8-3)9-4/h5-10H2,1-4H3;5-6H2,1-4H3.
What are the key properties of butyl(triethoxy)silane;trimethoxy(propyl)silane?
butyl(triethoxy)silane;trimethoxy(propyl)silane has a molecular weight of 384.66 g/mol, XLogP of 4.11, 14 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for butyl(triethoxy)silane;trimethoxy(propyl)silane is sourced from PubChem (CID 158050354), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).