butyl-diethoxy-methoxysilane;molecular hydrogen

C9H26O3Si — CID 161363700

IUPACbutyl-diethoxy-methoxysilane;molecular hydrogen
SMILESCCCC[Si](OC)(OCC)OCC.[H][H].[H][H]
InChIInChI=1S/C9H22O3Si.2H2/c1-5-8-9-13(10-4,11-6-2)12-7-3;;/h5-9H2,1-4H3;2*1H
InChIKeyVPNLNPHYVUHFRP-UHFFFAOYSA-N
MW210.39 g/mol
LogP2.94
Rot. Bonds8

About butyl-diethoxy-methoxysilane;molecular hydrogen

butyl-diethoxy-methoxysilane;molecular hydrogen (PubChem CID 161363700) has the molecular formula C9H26O3Si and a molecular weight of 210.39 g/mol. Its IUPAC name is butyl-diethoxy-methoxysilane;molecular hydrogen.

Molecular Properties

Compound Namebutyl-diethoxy-methoxysilane;molecular hydrogen
PubChem CID161363700
Molecular FormulaC9H26O3Si
Molecular Weight210.39 g/mol
Exact Mass210.17
IUPAC Namebutyl-diethoxy-methoxysilane;molecular hydrogen
SMILESCCCC[Si](OC)(OCC)OCC.[H][H].[H][H]
InChIInChI=1S/C9H22O3Si.2H2/c1-5-8-9-13(10-4,11-6-2)12-7-3;;/h5-9H2,1-4H3;2*1H
InChIKeyVPNLNPHYVUHFRP-UHFFFAOYSA-N
XLogP2.94
TPSA27.69 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds8
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500210.39
LogP ≤ 52.94
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}

Analyze butyl-diethoxy-methoxysilane;molecular hydrogen with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of butyl-diethoxy-methoxysilane;molecular hydrogen?
The IUPAC name of butyl-diethoxy-methoxysilane;molecular hydrogen (CID 161363700) is butyl-diethoxy-methoxysilane;molecular hydrogen.
What is the SMILES notation for butyl-diethoxy-methoxysilane;molecular hydrogen?
The canonical SMILES for butyl-diethoxy-methoxysilane;molecular hydrogen is CCCC[Si](OC)(OCC)OCC.[H][H].[H][H].
What is the InChIKey of butyl-diethoxy-methoxysilane;molecular hydrogen?
The InChIKey is VPNLNPHYVUHFRP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H22O3Si.2H2/c1-5-8-9-13(10-4,11-6-2)12-7-3;;/h5-9H2,1-4H3;2*1H.
What are the key properties of butyl-diethoxy-methoxysilane;molecular hydrogen?
butyl-diethoxy-methoxysilane;molecular hydrogen has a molecular weight of 210.39 g/mol, XLogP of 2.94, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for butyl-diethoxy-methoxysilane;molecular hydrogen is sourced from PubChem (CID 161363700), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).