About butyl(triethoxy)silane;tert-butyl(triethoxy)silane
butyl(triethoxy)silane;tert-butyl(triethoxy)silane (PubChem CID 175188929) has the molecular formula C20H48O6Si2
and a molecular weight of 440.77 g/mol. Its IUPAC name is butyl(triethoxy)silane;tert-butyl(triethoxy)silane.
Molecular Properties
| Compound Name | butyl(triethoxy)silane;tert-butyl(triethoxy)silane |
| PubChem CID | 175188929 |
| Molecular Formula | C20H48O6Si2 |
| Molecular Weight | 440.77 g/mol |
| Exact Mass | 440.30 |
| IUPAC Name | butyl(triethoxy)silane;tert-butyl(triethoxy)silane |
| SMILES | CCCC[Si](OCC)(OCC)OCC.CCO[Si](OCC)(OCC)C(C)(C)C |
| InChI | InChI=1S/2C10H24O3Si/c1-7-11-14(12-8-2,13-9-3)10(4,5)6;1-5-9-10-14(11-6-2,12-7-3)13-8-4/h7-9H2,1-6H3;5-10H2,1-4H3 |
| InChIKey | RULLUTAOKPOLMF-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 440.77 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze butyl(triethoxy)silane;tert-butyl(triethoxy)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butyl(triethoxy)silane;tert-butyl(triethoxy)silane?
The IUPAC name of butyl(triethoxy)silane;tert-butyl(triethoxy)silane (CID 175188929) is butyl(triethoxy)silane;tert-butyl(triethoxy)silane.
What is the SMILES notation for butyl(triethoxy)silane;tert-butyl(triethoxy)silane?
The canonical SMILES for butyl(triethoxy)silane;tert-butyl(triethoxy)silane is CCCC[Si](OCC)(OCC)OCC.CCO[Si](OCC)(OCC)C(C)(C)C.
What is the InChIKey of butyl(triethoxy)silane;tert-butyl(triethoxy)silane?
The InChIKey is RULLUTAOKPOLMF-UHFFFAOYSA-N. The full InChI is InChI=1S/2C10H24O3Si/c1-7-11-14(12-8-2,13-9-3)10(4,5)6;1-5-9-10-14(11-6-2,12-7-3)13-8-4/h7-9H2,1-6H3;5-10H2,1-4H3.
What are the key properties of butyl(triethoxy)silane;tert-butyl(triethoxy)silane?
butyl(triethoxy)silane;tert-butyl(triethoxy)silane has a molecular weight of 440.77 g/mol, XLogP of 5.67, 15 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for butyl(triethoxy)silane;tert-butyl(triethoxy)silane is sourced from PubChem (CID 175188929), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).