About butyl(triethoxy)silane;methanethioic S-acid
butyl(triethoxy)silane;methanethioic S-acid (PubChem CID 175031462) has the molecular formula C11H26O4SSi
and a molecular weight of 282.48 g/mol. Its IUPAC name is butyl(triethoxy)silane;methanethioic S-acid.
Molecular Properties
| Compound Name | butyl(triethoxy)silane;methanethioic S-acid |
| PubChem CID | 175031462 |
| Molecular Formula | C11H26O4SSi |
| Molecular Weight | 282.48 g/mol |
| Exact Mass | 282.13 |
| IUPAC Name | butyl(triethoxy)silane;methanethioic S-acid |
| SMILES | CCCC[Si](OCC)(OCC)OCC.O=CS |
| InChI | InChI=1S/C10H24O3Si.CH2OS/c1-5-9-10-14(11-6-2,12-7-3)13-8-4;2-1-3/h5-10H2,1-4H3;1H,(H,2,3) |
| InChIKey | PKJNOTBUNNHOOP-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 44.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.48 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze butyl(triethoxy)silane;methanethioic S-acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butyl(triethoxy)silane;methanethioic S-acid?
The IUPAC name of butyl(triethoxy)silane;methanethioic S-acid (CID 175031462) is butyl(triethoxy)silane;methanethioic S-acid.
What is the SMILES notation for butyl(triethoxy)silane;methanethioic S-acid?
The canonical SMILES for butyl(triethoxy)silane;methanethioic S-acid is CCCC[Si](OCC)(OCC)OCC.O=CS.
What is the InChIKey of butyl(triethoxy)silane;methanethioic S-acid?
The InChIKey is PKJNOTBUNNHOOP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H24O3Si.CH2OS/c1-5-9-10-14(11-6-2,12-7-3)13-8-4;2-1-3/h5-10H2,1-4H3;1H,(H,2,3).
What are the key properties of butyl(triethoxy)silane;methanethioic S-acid?
butyl(triethoxy)silane;methanethioic S-acid has a molecular weight of 282.48 g/mol, XLogP of 2.94, 9 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for butyl(triethoxy)silane;methanethioic S-acid is sourced from PubChem (CID 175031462), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).