About N-methylmethanamine;triethoxy(propyl)silane
N-methylmethanamine;triethoxy(propyl)silane (PubChem CID 22145973) has the molecular formula C11H29NO3Si
and a molecular weight of 251.44 g/mol. Its IUPAC name is N-methylmethanamine;triethoxy(propyl)silane.
Molecular Properties
| Compound Name | N-methylmethanamine;triethoxy(propyl)silane |
| PubChem CID | 22145973 |
| Molecular Formula | C11H29NO3Si |
| Molecular Weight | 251.44 g/mol |
| Exact Mass | 251.19 |
| IUPAC Name | N-methylmethanamine;triethoxy(propyl)silane |
| SMILES | CCC[Si](OCC)(OCC)OCC.CNC |
| InChI | InChI=1S/C9H22O3Si.C2H7N/c1-5-9-13(10-6-2,11-7-3)12-8-4;1-3-2/h5-9H2,1-4H3;3H,1-2H3 |
| InChIKey | IWDYVHIVLWWGEG-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.44 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze N-methylmethanamine;triethoxy(propyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methylmethanamine;triethoxy(propyl)silane?
The IUPAC name of N-methylmethanamine;triethoxy(propyl)silane (CID 22145973) is N-methylmethanamine;triethoxy(propyl)silane.
What is the SMILES notation for N-methylmethanamine;triethoxy(propyl)silane?
The canonical SMILES for N-methylmethanamine;triethoxy(propyl)silane is CCC[Si](OCC)(OCC)OCC.CNC.
What is the InChIKey of N-methylmethanamine;triethoxy(propyl)silane?
The InChIKey is IWDYVHIVLWWGEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H22O3Si.C2H7N/c1-5-9-13(10-6-2,11-7-3)12-8-4;1-3-2/h5-9H2,1-4H3;3H,1-2H3.
What are the key properties of N-methylmethanamine;triethoxy(propyl)silane?
N-methylmethanamine;triethoxy(propyl)silane has a molecular weight of 251.44 g/mol, XLogP of 2.28, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-methylmethanamine;triethoxy(propyl)silane is sourced from PubChem (CID 22145973), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).