About ethyl(tripropoxy)silane;triethoxy(propyl)silane
ethyl(tripropoxy)silane;triethoxy(propyl)silane (PubChem CID 19799420) has the molecular formula C20H48O6Si2
and a molecular weight of 440.77 g/mol. Its IUPAC name is ethyl(tripropoxy)silane;triethoxy(propyl)silane.
Molecular Properties
| Compound Name | ethyl(tripropoxy)silane;triethoxy(propyl)silane |
| PubChem CID | 19799420 |
| Molecular Formula | C20H48O6Si2 |
| Molecular Weight | 440.77 g/mol |
| Exact Mass | 440.30 |
| IUPAC Name | ethyl(tripropoxy)silane;triethoxy(propyl)silane |
| SMILES | CCCO[Si](CC)(OCCC)OCCC.CCC[Si](OCC)(OCC)OCC |
| InChI | InChI=1S/C11H26O3Si.C9H22O3Si/c1-5-9-12-15(8-4,13-10-6-2)14-11-7-3;1-5-9-13(10-6-2,11-7-3)12-8-4/h5-11H2,1-4H3;5-9H2,1-4H3 |
| InChIKey | NVBSOWDXOXFZGH-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 440.77 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze ethyl(tripropoxy)silane;triethoxy(propyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl(tripropoxy)silane;triethoxy(propyl)silane?
The IUPAC name of ethyl(tripropoxy)silane;triethoxy(propyl)silane (CID 19799420) is ethyl(tripropoxy)silane;triethoxy(propyl)silane.
What is the SMILES notation for ethyl(tripropoxy)silane;triethoxy(propyl)silane?
The canonical SMILES for ethyl(tripropoxy)silane;triethoxy(propyl)silane is CCCO[Si](CC)(OCCC)OCCC.CCC[Si](OCC)(OCC)OCC.
What is the InChIKey of ethyl(tripropoxy)silane;triethoxy(propyl)silane?
The InChIKey is NVBSOWDXOXFZGH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H26O3Si.C9H22O3Si/c1-5-9-12-15(8-4,13-10-6-2)14-11-7-3;1-5-9-13(10-6-2,11-7-3)12-8-4/h5-11H2,1-4H3;5-9H2,1-4H3.
What are the key properties of ethyl(tripropoxy)silane;triethoxy(propyl)silane?
ethyl(tripropoxy)silane;triethoxy(propyl)silane has a molecular weight of 440.77 g/mol, XLogP of 5.67, 18 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl(tripropoxy)silane;triethoxy(propyl)silane is sourced from PubChem (CID 19799420), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).