About tetrapropyl silicate;triethoxy(propyl)silane
tetrapropyl silicate;triethoxy(propyl)silane (PubChem CID 174059374) has the molecular formula C21H50O7Si2
and a molecular weight of 470.80 g/mol. Its IUPAC name is tetrapropyl silicate;triethoxy(propyl)silane.
Molecular Properties
| Compound Name | tetrapropyl silicate;triethoxy(propyl)silane |
| PubChem CID | 174059374 |
| Molecular Formula | C21H50O7Si2 |
| Molecular Weight | 470.80 g/mol |
| Exact Mass | 470.31 |
| IUPAC Name | tetrapropyl silicate;triethoxy(propyl)silane |
| SMILES | CCCO[Si](OCCC)(OCCC)OCCC.CCC[Si](OCC)(OCC)OCC |
| InChI | InChI=1S/C12H28O4Si.C9H22O3Si/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;1-5-9-13(10-6-2,11-7-3)12-8-4/h5-12H2,1-4H3;5-9H2,1-4H3 |
| InChIKey | ZQZNXOSMVBGXPQ-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 64.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 470.80 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze tetrapropyl silicate;triethoxy(propyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tetrapropyl silicate;triethoxy(propyl)silane?
The IUPAC name of tetrapropyl silicate;triethoxy(propyl)silane (CID 174059374) is tetrapropyl silicate;triethoxy(propyl)silane.
What is the SMILES notation for tetrapropyl silicate;triethoxy(propyl)silane?
The canonical SMILES for tetrapropyl silicate;triethoxy(propyl)silane is CCCO[Si](OCCC)(OCCC)OCCC.CCC[Si](OCC)(OCC)OCC.
What is the InChIKey of tetrapropyl silicate;triethoxy(propyl)silane?
The InChIKey is ZQZNXOSMVBGXPQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H28O4Si.C9H22O3Si/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;1-5-9-13(10-6-2,11-7-3)12-8-4/h5-12H2,1-4H3;5-9H2,1-4H3.
What are the key properties of tetrapropyl silicate;triethoxy(propyl)silane?
tetrapropyl silicate;triethoxy(propyl)silane has a molecular weight of 470.80 g/mol, XLogP of 5.57, 20 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for tetrapropyl silicate;triethoxy(propyl)silane is sourced from PubChem (CID 174059374), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).