About thiocyanic acid;triethoxy(propyl)silane
thiocyanic acid;triethoxy(propyl)silane (PubChem CID 172793282) has the molecular formula C10H23NO3SSi
and a molecular weight of 265.45 g/mol. Its IUPAC name is thiocyanic acid;triethoxy(propyl)silane.
Molecular Properties
| Compound Name | thiocyanic acid;triethoxy(propyl)silane |
| PubChem CID | 172793282 |
| Molecular Formula | C10H23NO3SSi |
| Molecular Weight | 265.45 g/mol |
| Exact Mass | 265.12 |
| IUPAC Name | thiocyanic acid;triethoxy(propyl)silane |
| SMILES | CCC[Si](OCC)(OCC)OCC.N#CS |
| InChI | InChI=1S/C9H22O3Si.CHNS/c1-5-9-13(10-6-2,11-7-3)12-8-4;2-1-3/h5-9H2,1-4H3;3H |
| InChIKey | PWAQGOPSFBETSG-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 51.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.45 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze thiocyanic acid;triethoxy(propyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of thiocyanic acid;triethoxy(propyl)silane?
The IUPAC name of thiocyanic acid;triethoxy(propyl)silane (CID 172793282) is thiocyanic acid;triethoxy(propyl)silane.
What is the SMILES notation for thiocyanic acid;triethoxy(propyl)silane?
The canonical SMILES for thiocyanic acid;triethoxy(propyl)silane is CCC[Si](OCC)(OCC)OCC.N#CS.
What is the InChIKey of thiocyanic acid;triethoxy(propyl)silane?
The InChIKey is PWAQGOPSFBETSG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H22O3Si.CHNS/c1-5-9-13(10-6-2,11-7-3)12-8-4;2-1-3/h5-9H2,1-4H3;3H.
What are the key properties of thiocyanic acid;triethoxy(propyl)silane?
thiocyanic acid;triethoxy(propyl)silane has a molecular weight of 265.45 g/mol, XLogP of 2.84, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for thiocyanic acid;triethoxy(propyl)silane is sourced from PubChem (CID 172793282), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).