About carbamic acid;triethoxy(propyl)silane
carbamic acid;triethoxy(propyl)silane (PubChem CID 175441799) has the molecular formula C10H25NO5Si
and a molecular weight of 267.40 g/mol. Its IUPAC name is carbamic acid;triethoxy(propyl)silane.
Molecular Properties
| Compound Name | carbamic acid;triethoxy(propyl)silane |
| PubChem CID | 175441799 |
| Molecular Formula | C10H25NO5Si |
| Molecular Weight | 267.40 g/mol |
| Exact Mass | 267.15 |
| IUPAC Name | carbamic acid;triethoxy(propyl)silane |
| SMILES | CCC[Si](OCC)(OCC)OCC.NC(=O)O |
| InChI | InChI=1S/C9H22O3Si.CH3NO2/c1-5-9-13(10-6-2,11-7-3)12-8-4;2-1(3)4/h5-9H2,1-4H3;2H2,(H,3,4) |
| InChIKey | HSOZISINODBTOA-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 91.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.40 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze carbamic acid;triethoxy(propyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbamic acid;triethoxy(propyl)silane?
The IUPAC name of carbamic acid;triethoxy(propyl)silane (CID 175441799) is carbamic acid;triethoxy(propyl)silane.
What is the SMILES notation for carbamic acid;triethoxy(propyl)silane?
The canonical SMILES for carbamic acid;triethoxy(propyl)silane is CCC[Si](OCC)(OCC)OCC.NC(=O)O.
What is the InChIKey of carbamic acid;triethoxy(propyl)silane?
The InChIKey is HSOZISINODBTOA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H22O3Si.CH3NO2/c1-5-9-13(10-6-2,11-7-3)12-8-4;2-1(3)4/h5-9H2,1-4H3;2H2,(H,3,4).
What are the key properties of carbamic acid;triethoxy(propyl)silane?
carbamic acid;triethoxy(propyl)silane has a molecular weight of 267.40 g/mol, XLogP of 2.07, 8 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for carbamic acid;triethoxy(propyl)silane is sourced from PubChem (CID 175441799), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).