About 2-methylprop-2-enoic acid;triethoxy(propyl)silane
2-methylprop-2-enoic acid;triethoxy(propyl)silane (PubChem CID 87573070) has the molecular formula C13H28O5Si
and a molecular weight of 292.45 g/mol. Its IUPAC name is 2-methylprop-2-enoic acid;triethoxy(propyl)silane.
Molecular Properties
| Compound Name | 2-methylprop-2-enoic acid;triethoxy(propyl)silane |
| PubChem CID | 87573070 |
| Molecular Formula | C13H28O5Si |
| Molecular Weight | 292.45 g/mol |
| Exact Mass | 292.17 |
| IUPAC Name | 2-methylprop-2-enoic acid;triethoxy(propyl)silane |
| SMILES | C=C(C)C(=O)O.CCC[Si](OCC)(OCC)OCC |
| InChI | InChI=1S/C9H22O3Si.C4H6O2/c1-5-9-13(10-6-2,11-7-3)12-8-4;1-3(2)4(5)6/h5-9H2,1-4H3;1H2,2H3,(H,5,6) |
| InChIKey | FZTUOBCLWBAQMC-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.45 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-methylprop-2-enoic acid;triethoxy(propyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylprop-2-enoic acid;triethoxy(propyl)silane?
The IUPAC name of 2-methylprop-2-enoic acid;triethoxy(propyl)silane (CID 87573070) is 2-methylprop-2-enoic acid;triethoxy(propyl)silane.
What is the SMILES notation for 2-methylprop-2-enoic acid;triethoxy(propyl)silane?
The canonical SMILES for 2-methylprop-2-enoic acid;triethoxy(propyl)silane is C=C(C)C(=O)O.CCC[Si](OCC)(OCC)OCC.
What is the InChIKey of 2-methylprop-2-enoic acid;triethoxy(propyl)silane?
The InChIKey is FZTUOBCLWBAQMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H22O3Si.C4H6O2/c1-5-9-13(10-6-2,11-7-3)12-8-4;1-3(2)4(5)6/h5-9H2,1-4H3;1H2,2H3,(H,5,6).
What are the key properties of 2-methylprop-2-enoic acid;triethoxy(propyl)silane?
2-methylprop-2-enoic acid;triethoxy(propyl)silane has a molecular weight of 292.45 g/mol, XLogP of 3.09, 9 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylprop-2-enoic acid;triethoxy(propyl)silane is sourced from PubChem (CID 87573070), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).