C12H28N2O5Si — CID 160747062
1-[dimethoxy(propyl)silyl]oxypropane-1,1-diamine;2-methylprop-2-enoic acid (PubChem CID 160747062) has the molecular formula C12H28N2O5Si and a molecular weight of 308.45 g/mol. Its IUPAC name is 1-[dimethoxy(propyl)silyl]oxypropane-1,1-diamine;2-methylprop-2-enoic acid.
| Compound Name | 1-[dimethoxy(propyl)silyl]oxypropane-1,1-diamine;2-methylprop-2-enoic acid |
|---|---|
| PubChem CID | 160747062 |
| Molecular Formula | C12H28N2O5Si |
| Molecular Weight | 308.45 g/mol |
| Exact Mass | 308.18 |
| IUPAC Name | 1-[dimethoxy(propyl)silyl]oxypropane-1,1-diamine;2-methylprop-2-enoic acid |
| SMILES | C=C(C)C(=O)O.CCC[Si](OC)(OC)OC(N)(N)CC |
| InChI | InChI=1S/C8H22N2O3Si.C4H6O2/c1-5-7-14(11-3,12-4)13-8(9,10)6-2;1-3(2)4(5)6/h5-7,9-10H2,1-4H3;1H2,2H3,(H,5,6) |
| InChIKey | RWIAXMHLBQJJPZ-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 117.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.45 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|