About 2-methylprop-2-enoate;trimethoxy(propyl)silane
2-methylprop-2-enoate;trimethoxy(propyl)silane (PubChem CID 22007225) has the molecular formula C10H21O5Si-
and a molecular weight of 249.36 g/mol. Its IUPAC name is 2-methylprop-2-enoate;trimethoxy(propyl)silane.
Molecular Properties
| Compound Name | 2-methylprop-2-enoate;trimethoxy(propyl)silane |
| PubChem CID | 22007225 |
| Molecular Formula | C10H21O5Si- |
| Molecular Weight | 249.36 g/mol |
| Exact Mass | 249.12 |
| IUPAC Name | 2-methylprop-2-enoate;trimethoxy(propyl)silane |
| SMILES | C=C(C)C(=O)[O-].CCC[Si](OC)(OC)OC |
| InChI | InChI=1S/C6H16O3Si.C4H6O2/c1-5-6-10(7-2,8-3)9-4;1-3(2)4(5)6/h5-6H2,1-4H3;1H2,2H3,(H,5,6)/p-1 |
| InChIKey | YNEHCIJMLGCQIS-UHFFFAOYSA-M |
| XLogP | 0.59 |
| TPSA | 67.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.36 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-methylprop-2-enoate;trimethoxy(propyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylprop-2-enoate;trimethoxy(propyl)silane?
The IUPAC name of 2-methylprop-2-enoate;trimethoxy(propyl)silane (CID 22007225) is 2-methylprop-2-enoate;trimethoxy(propyl)silane.
What is the SMILES notation for 2-methylprop-2-enoate;trimethoxy(propyl)silane?
The canonical SMILES for 2-methylprop-2-enoate;trimethoxy(propyl)silane is C=C(C)C(=O)[O-].CCC[Si](OC)(OC)OC.
What is the InChIKey of 2-methylprop-2-enoate;trimethoxy(propyl)silane?
The InChIKey is YNEHCIJMLGCQIS-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H16O3Si.C4H6O2/c1-5-6-10(7-2,8-3)9-4;1-3(2)4(5)6/h5-6H2,1-4H3;1H2,2H3,(H,5,6)/p-1.
What are the key properties of 2-methylprop-2-enoate;trimethoxy(propyl)silane?
2-methylprop-2-enoate;trimethoxy(propyl)silane has a molecular weight of 249.36 g/mol, XLogP of 0.59, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylprop-2-enoate;trimethoxy(propyl)silane is sourced from PubChem (CID 22007225), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).