About azane;bis(trimethoxy(propyl)silane)
azane;bis(trimethoxy(propyl)silane) (PubChem CID 87892957) has the molecular formula C12H35NO6Si2
and a molecular weight of 345.59 g/mol. Its IUPAC name is azane;bis(trimethoxy(propyl)silane).
Molecular Properties
| Compound Name | azane;bis(trimethoxy(propyl)silane) |
| PubChem CID | 87892957 |
| Molecular Formula | C12H35NO6Si2 |
| Molecular Weight | 345.59 g/mol |
| Exact Mass | 345.20 |
| IUPAC Name | azane;bis(trimethoxy(propyl)silane) |
| SMILES | CCC[Si](OC)(OC)OC.CCC[Si](OC)(OC)OC.N |
| InChI | InChI=1S/2C6H16O3Si.H3N/c2*1-5-6-10(7-2,8-3)9-4;/h2*5-6H2,1-4H3;1H3 |
| InChIKey | PWCYJRSFHJKUGV-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 90.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.59 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze azane;bis(trimethoxy(propyl)silane) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;bis(trimethoxy(propyl)silane)?
The IUPAC name of azane;bis(trimethoxy(propyl)silane) (CID 87892957) is azane;bis(trimethoxy(propyl)silane).
What is the SMILES notation for azane;bis(trimethoxy(propyl)silane)?
The canonical SMILES for azane;bis(trimethoxy(propyl)silane) is CCC[Si](OC)(OC)OC.CCC[Si](OC)(OC)OC.N.
What is the InChIKey of azane;bis(trimethoxy(propyl)silane)?
The InChIKey is PWCYJRSFHJKUGV-UHFFFAOYSA-N. The full InChI is InChI=1S/2C6H16O3Si.H3N/c2*1-5-6-10(7-2,8-3)9-4;/h2*5-6H2,1-4H3;1H3.
What are the key properties of azane;bis(trimethoxy(propyl)silane)?
azane;bis(trimethoxy(propyl)silane) has a molecular weight of 345.59 g/mol, XLogP of 2.71, 10 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for azane;bis(trimethoxy(propyl)silane) is sourced from PubChem (CID 87892957), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).