About propan-2-imine;trimethoxy(propyl)silane
propan-2-imine;trimethoxy(propyl)silane (PubChem CID 174526925) has the molecular formula C9H23NO3Si
and a molecular weight of 221.37 g/mol. Its IUPAC name is propan-2-imine;trimethoxy(propyl)silane.
Molecular Properties
| Compound Name | propan-2-imine;trimethoxy(propyl)silane |
| PubChem CID | 174526925 |
| Molecular Formula | C9H23NO3Si |
| Molecular Weight | 221.37 g/mol |
| Exact Mass | 221.14 |
| IUPAC Name | propan-2-imine;trimethoxy(propyl)silane |
| SMILES | CCC[Si](OC)(OC)OC.[H]N=C(C)C |
| InChI | InChI=1S/C6H16O3Si.C3H7N/c1-5-6-10(7-2,8-3)9-4;1-3(2)4/h5-6H2,1-4H3;4H,1-2H3 |
| InChIKey | KHDSOMRHGNXGRM-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 51.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.37 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze propan-2-imine;trimethoxy(propyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-imine;trimethoxy(propyl)silane?
The IUPAC name of propan-2-imine;trimethoxy(propyl)silane (CID 174526925) is propan-2-imine;trimethoxy(propyl)silane.
What is the SMILES notation for propan-2-imine;trimethoxy(propyl)silane?
The canonical SMILES for propan-2-imine;trimethoxy(propyl)silane is CCC[Si](OC)(OC)OC.[H]N=C(C)C.
What is the InChIKey of propan-2-imine;trimethoxy(propyl)silane?
The InChIKey is KHDSOMRHGNXGRM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H16O3Si.C3H7N/c1-5-6-10(7-2,8-3)9-4;1-3(2)4/h5-6H2,1-4H3;4H,1-2H3.
What are the key properties of propan-2-imine;trimethoxy(propyl)silane?
propan-2-imine;trimethoxy(propyl)silane has a molecular weight of 221.37 g/mol, XLogP of 2.32, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-imine;trimethoxy(propyl)silane is sourced from PubChem (CID 174526925), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).