About 2-methylprop-2-enoate
2-methylprop-2-enoate (PubChem CID 19005746) has the molecular formula C12H15O6-3
and a molecular weight of 255.25 g/mol. Its IUPAC name is 2-methylprop-2-enoate.
Molecular Properties
| Compound Name | 2-methylprop-2-enoate |
| PubChem CID | 19005746 |
| Molecular Formula | C12H15O6-3 |
| Molecular Weight | 255.25 g/mol |
| Exact Mass | 255.09 |
| IUPAC Name | 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)[O-].C=C(C)C(=O)[O-].C=C(C)C(=O)[O-] |
| InChI | InChI=1S/3C4H6O2/c3*1-3(2)4(5)6/h3*1H2,2H3,(H,5,6)/p-3 |
| InChIKey | CUOYGVNOMILKIC-UHFFFAOYSA-K |
| XLogP | -2.06 |
| TPSA | 120.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.25 |
| LogP ≤ 5 | -2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-methylprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylprop-2-enoate?
The IUPAC name of 2-methylprop-2-enoate (CID 19005746) is 2-methylprop-2-enoate.
What is the SMILES notation for 2-methylprop-2-enoate?
The canonical SMILES for 2-methylprop-2-enoate is C=C(C)C(=O)[O-].C=C(C)C(=O)[O-].C=C(C)C(=O)[O-].
What is the InChIKey of 2-methylprop-2-enoate?
The InChIKey is CUOYGVNOMILKIC-UHFFFAOYSA-K. The full InChI is InChI=1S/3C4H6O2/c3*1-3(2)4(5)6/h3*1H2,2H3,(H,5,6)/p-3.
What are the key properties of 2-methylprop-2-enoate?
2-methylprop-2-enoate has a molecular weight of 255.25 g/mol, XLogP of -2.06, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylprop-2-enoate is sourced from PubChem (CID 19005746), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).