About 2-methylprop-2-enoate isocyanate
2-methylprop-2-enoate isocyanate (PubChem CID 86653408) has the molecular formula C5H5NO3-2
and a molecular weight of 127.10 g/mol. Its IUPAC name is 2-methylprop-2-enoate isocyanate.
Molecular Properties
| Compound Name | 2-methylprop-2-enoate isocyanate |
| PubChem CID | 86653408 |
| Molecular Formula | C5H5NO3-2 |
| Molecular Weight | 127.10 g/mol |
| Exact Mass | 127.03 |
| IUPAC Name | 2-methylprop-2-enoate isocyanate |
| SMILES | C=C(C)C(=O)[O-].[N-]=C=O |
| InChI | InChI=1S/C4H6O2.CNO/c1-3(2)4(5)6;2-1-3/h1H2,2H3,(H,5,6);/q;-1/p-1 |
| InChIKey | LAJNWAHYDRDIGA-UHFFFAOYSA-M |
| XLogP | -0.80 |
| TPSA | 79.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 127.10 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-methylprop-2-enoate isocyanate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylprop-2-enoate isocyanate?
The IUPAC name of 2-methylprop-2-enoate isocyanate (CID 86653408) is 2-methylprop-2-enoate isocyanate.
What is the SMILES notation for 2-methylprop-2-enoate isocyanate?
The canonical SMILES for 2-methylprop-2-enoate isocyanate is C=C(C)C(=O)[O-].[N-]=C=O.
What is the InChIKey of 2-methylprop-2-enoate isocyanate?
The InChIKey is LAJNWAHYDRDIGA-UHFFFAOYSA-M. The full InChI is InChI=1S/C4H6O2.CNO/c1-3(2)4(5)6;2-1-3/h1H2,2H3,(H,5,6);/q;-1/p-1.
What are the key properties of 2-methylprop-2-enoate isocyanate?
2-methylprop-2-enoate isocyanate has a molecular weight of 127.10 g/mol, XLogP of -0.80, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylprop-2-enoate isocyanate is sourced from PubChem (CID 86653408), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).