About chromium(3+);2-methylprop-2-enoate;chloride
chromium(3+);2-methylprop-2-enoate;chloride (PubChem CID 19738661) has the molecular formula C4H5ClCrO2+
and a molecular weight of 172.53 g/mol. Its IUPAC name is chromium(3+);2-methylprop-2-enoate;chloride.
Molecular Properties
| Compound Name | chromium(3+);2-methylprop-2-enoate;chloride |
| PubChem CID | 19738661 |
| Molecular Formula | C4H5ClCrO2+ |
| Molecular Weight | 172.53 g/mol |
| Exact Mass | 171.94 |
| IUPAC Name | chromium(3+);2-methylprop-2-enoate;chloride |
| SMILES | C=C(C)C(=O)[O-].[Cl-].[Cr+3] |
| InChI | InChI=1S/C4H6O2.ClH.Cr/c1-3(2)4(5)6;;/h1H2,2H3,(H,5,6);1H;/q;;+3/p-2 |
| InChIKey | FVESWZUSWBBVJY-UHFFFAOYSA-L |
| XLogP | -3.69 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.53 |
| LogP ≤ 5 | -3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze chromium(3+);2-methylprop-2-enoate;chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chromium(3+);2-methylprop-2-enoate;chloride?
The IUPAC name of chromium(3+);2-methylprop-2-enoate;chloride (CID 19738661) is chromium(3+);2-methylprop-2-enoate;chloride.
What is the SMILES notation for chromium(3+);2-methylprop-2-enoate;chloride?
The canonical SMILES for chromium(3+);2-methylprop-2-enoate;chloride is C=C(C)C(=O)[O-].[Cl-].[Cr+3].
What is the InChIKey of chromium(3+);2-methylprop-2-enoate;chloride?
The InChIKey is FVESWZUSWBBVJY-UHFFFAOYSA-L. The full InChI is InChI=1S/C4H6O2.ClH.Cr/c1-3(2)4(5)6;;/h1H2,2H3,(H,5,6);1H;/q;;+3/p-2.
What are the key properties of chromium(3+);2-methylprop-2-enoate;chloride?
chromium(3+);2-methylprop-2-enoate;chloride has a molecular weight of 172.53 g/mol, XLogP of -3.69, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for chromium(3+);2-methylprop-2-enoate;chloride is sourced from PubChem (CID 19738661), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).