About 2-methylprop-2-enoate;trifluoromethane
2-methylprop-2-enoate;trifluoromethane (PubChem CID 158491697) has the molecular formula C5H5F3O2
and a molecular weight of 154.09 g/mol. Its IUPAC name is 2-methylprop-2-enoate;trifluoromethane.
Molecular Properties
| Compound Name | 2-methylprop-2-enoate;trifluoromethane |
| PubChem CID | 158491697 |
| Molecular Formula | C5H5F3O2 |
| Molecular Weight | 154.09 g/mol |
| Exact Mass | 154.02 |
| IUPAC Name | 2-methylprop-2-enoate;trifluoromethane |
| SMILES | C=C(C)C(=O)[O-].F[C+](F)F |
| InChI | InChI=1S/C4H6O2.CF3/c1-3(2)4(5)6;2-1(3)4/h1H2,2H3,(H,5,6);/q;+1/p-1 |
| InChIKey | HITUYOHIZFBOQS-UHFFFAOYSA-M |
| XLogP | 0.65 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.09 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-methylprop-2-enoate;trifluoromethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylprop-2-enoate;trifluoromethane?
The IUPAC name of 2-methylprop-2-enoate;trifluoromethane (CID 158491697) is 2-methylprop-2-enoate;trifluoromethane.
What is the SMILES notation for 2-methylprop-2-enoate;trifluoromethane?
The canonical SMILES for 2-methylprop-2-enoate;trifluoromethane is C=C(C)C(=O)[O-].F[C+](F)F.
What is the InChIKey of 2-methylprop-2-enoate;trifluoromethane?
The InChIKey is HITUYOHIZFBOQS-UHFFFAOYSA-M. The full InChI is InChI=1S/C4H6O2.CF3/c1-3(2)4(5)6;2-1(3)4/h1H2,2H3,(H,5,6);/q;+1/p-1.
What are the key properties of 2-methylprop-2-enoate;trifluoromethane?
2-methylprop-2-enoate;trifluoromethane has a molecular weight of 154.09 g/mol, XLogP of 0.65, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylprop-2-enoate;trifluoromethane is sourced from PubChem (CID 158491697), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).