About bis(2-methylprop-2-enoate);samarium
bis(2-methylprop-2-enoate);samarium (PubChem CID 175299700) has the molecular formula C8H10O4Sm-2
and a molecular weight of 320.52 g/mol. Its IUPAC name is bis(2-methylprop-2-enoate);samarium.
Molecular Properties
| Compound Name | bis(2-methylprop-2-enoate);samarium |
| PubChem CID | 175299700 |
| Molecular Formula | C8H10O4Sm-2 |
| Molecular Weight | 320.52 g/mol |
| Exact Mass | 321.98 |
| IUPAC Name | bis(2-methylprop-2-enoate);samarium |
| SMILES | C=C(C)C(=O)[O-].C=C(C)C(=O)[O-].[Sm] |
| InChI | InChI=1S/2C4H6O2.Sm/c2*1-3(2)4(5)6;/h2*1H2,2H3,(H,5,6);/p-2 |
| InChIKey | GJNCYYUQSDENHI-UHFFFAOYSA-L |
| XLogP | -1.38 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.52 |
| LogP ≤ 5 | -1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze bis(2-methylprop-2-enoate);samarium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2-methylprop-2-enoate);samarium?
The IUPAC name of bis(2-methylprop-2-enoate);samarium (CID 175299700) is bis(2-methylprop-2-enoate);samarium.
What is the SMILES notation for bis(2-methylprop-2-enoate);samarium?
The canonical SMILES for bis(2-methylprop-2-enoate);samarium is C=C(C)C(=O)[O-].C=C(C)C(=O)[O-].[Sm].
What is the InChIKey of bis(2-methylprop-2-enoate);samarium?
The InChIKey is GJNCYYUQSDENHI-UHFFFAOYSA-L. The full InChI is InChI=1S/2C4H6O2.Sm/c2*1-3(2)4(5)6;/h2*1H2,2H3,(H,5,6);/p-2.
What are the key properties of bis(2-methylprop-2-enoate);samarium?
bis(2-methylprop-2-enoate);samarium has a molecular weight of 320.52 g/mol, XLogP of -1.38, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2-methylprop-2-enoate);samarium is sourced from PubChem (CID 175299700), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).