About calcium;2-methylprop-2-enoate;chloride
calcium;2-methylprop-2-enoate;chloride (PubChem CID 174912380) has the molecular formula C4H5CaClO2
and a molecular weight of 160.61 g/mol. Its IUPAC name is calcium;2-methylprop-2-enoate;chloride.
Molecular Properties
| Compound Name | calcium;2-methylprop-2-enoate;chloride |
| PubChem CID | 174912380 |
| Molecular Formula | C4H5CaClO2 |
| Molecular Weight | 160.61 g/mol |
| Exact Mass | 159.96 |
| IUPAC Name | calcium;2-methylprop-2-enoate;chloride |
| SMILES | C=C(C)C(=O)[O-].[Ca+2].[Cl-] |
| InChI | InChI=1S/C4H6O2.Ca.ClH/c1-3(2)4(5)6;;/h1H2,2H3,(H,5,6);;1H/q;+2;/p-2 |
| InChIKey | YBCKLUUZSPRIAZ-UHFFFAOYSA-L |
| XLogP | -4.06 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.61 |
| LogP ≤ 5 | -4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze calcium;2-methylprop-2-enoate;chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of calcium;2-methylprop-2-enoate;chloride?
The IUPAC name of calcium;2-methylprop-2-enoate;chloride (CID 174912380) is calcium;2-methylprop-2-enoate;chloride.
What is the SMILES notation for calcium;2-methylprop-2-enoate;chloride?
The canonical SMILES for calcium;2-methylprop-2-enoate;chloride is C=C(C)C(=O)[O-].[Ca+2].[Cl-].
What is the InChIKey of calcium;2-methylprop-2-enoate;chloride?
The InChIKey is YBCKLUUZSPRIAZ-UHFFFAOYSA-L. The full InChI is InChI=1S/C4H6O2.Ca.ClH/c1-3(2)4(5)6;;/h1H2,2H3,(H,5,6);;1H/q;+2;/p-2.
What are the key properties of calcium;2-methylprop-2-enoate;chloride?
calcium;2-methylprop-2-enoate;chloride has a molecular weight of 160.61 g/mol, XLogP of -4.06, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for calcium;2-methylprop-2-enoate;chloride is sourced from PubChem (CID 174912380), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).