C9H24N2O3Si — CID 88723815
1-[dimethoxy(propyl)silyl]oxybutane-1,1-diamine (PubChem CID 88723815) has the molecular formula C9H24N2O3Si and a molecular weight of 236.39 g/mol. Its IUPAC name is 1-[dimethoxy(propyl)silyl]oxybutane-1,1-diamine.
| Compound Name | 1-[dimethoxy(propyl)silyl]oxybutane-1,1-diamine |
|---|---|
| PubChem CID | 88723815 |
| Molecular Formula | C9H24N2O3Si |
| Molecular Weight | 236.39 g/mol |
| Exact Mass | 236.16 |
| IUPAC Name | 1-[dimethoxy(propyl)silyl]oxybutane-1,1-diamine |
| SMILES | CCCC(N)(N)O[Si](CCC)(OC)OC |
| InChI | InChI=1S/C9H24N2O3Si/c1-5-7-9(10,11)14-15(12-3,13-4)8-6-2/h5-8,10-11H2,1-4H3 |
| InChIKey | NLSULWJSOBENBL-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 79.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.39 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|