C10H25NO3Si — CID 87698834
1-[dimethoxy(propyl)silyl]oxy-2,2-dimethylpropan-1-amine (PubChem CID 87698834) has the molecular formula C10H25NO3Si and a molecular weight of 235.40 g/mol. Its IUPAC name is 1-[dimethoxy(propyl)silyl]oxy-2,2-dimethylpropan-1-amine.
| Compound Name | 1-[dimethoxy(propyl)silyl]oxy-2,2-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 87698834 |
| Molecular Formula | C10H25NO3Si |
| Molecular Weight | 235.40 g/mol |
| Exact Mass | 235.16 |
| IUPAC Name | 1-[dimethoxy(propyl)silyl]oxy-2,2-dimethylpropan-1-amine |
| SMILES | CCC[Si](OC)(OC)OC(N)C(C)(C)C |
| InChI | InChI=1S/C10H25NO3Si/c1-7-8-15(12-5,13-6)14-9(11)10(2,3)4/h9H,7-8,11H2,1-6H3 |
| InChIKey | HUGYJNMHCHRFOW-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.40 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|