C12H32N2O3Si — CID 175401211
hexane-1,1-diamine;trimethoxy(propyl)silane (PubChem CID 175401211) has the molecular formula C12H32N2O3Si and a molecular weight of 280.49 g/mol. Its IUPAC name is hexane-1,1-diamine;trimethoxy(propyl)silane.
| Compound Name | hexane-1,1-diamine;trimethoxy(propyl)silane |
|---|---|
| PubChem CID | 175401211 |
| Molecular Formula | C12H32N2O3Si |
| Molecular Weight | 280.49 g/mol |
| Exact Mass | 280.22 |
| IUPAC Name | hexane-1,1-diamine;trimethoxy(propyl)silane |
| SMILES | CCCCCC(N)N.CCC[Si](OC)(OC)OC |
| InChI | InChI=1S/C6H16N2.C6H16O3Si/c1-2-3-4-5-6(7)8;1-5-6-10(7-2,8-3)9-4/h6H,2-5,7-8H2,1H3;5-6H2,1-4H3 |
| InChIKey | AHWPYMQIUCQURN-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 79.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.49 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|