C12H32N2O3Si — CID 174757276
hexane;3-trimethoxysilylpropane-1,1-diamine (PubChem CID 174757276) has the molecular formula C12H32N2O3Si and a molecular weight of 280.49 g/mol. Its IUPAC name is hexane;3-trimethoxysilylpropane-1,1-diamine.
| Compound Name | hexane;3-trimethoxysilylpropane-1,1-diamine |
|---|---|
| PubChem CID | 174757276 |
| Molecular Formula | C12H32N2O3Si |
| Molecular Weight | 280.49 g/mol |
| Exact Mass | 280.22 |
| IUPAC Name | hexane;3-trimethoxysilylpropane-1,1-diamine |
| SMILES | CCCCCC.CO[Si](CCC(N)N)(OC)OC |
| InChI | InChI=1S/C6H18N2O3Si.C6H14/c1-9-12(10-2,11-3)5-4-6(7)8;1-3-5-6-4-2/h6H,4-5,7-8H2,1-3H3;3-6H2,1-2H3 |
| InChIKey | YXCSAMHSAJYLNB-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 79.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.49 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|