C11H29NO6Si2 — CID 87668176
1,5-bis(trimethoxysilyl)pentan-3-amine (PubChem CID 87668176) has the molecular formula C11H29NO6Si2 and a molecular weight of 327.53 g/mol. Its IUPAC name is 1,5-bis(trimethoxysilyl)pentan-3-amine.
| Compound Name | 1,5-bis(trimethoxysilyl)pentan-3-amine |
|---|---|
| PubChem CID | 87668176 |
| Molecular Formula | C11H29NO6Si2 |
| Molecular Weight | 327.53 g/mol |
| Exact Mass | 327.15 |
| IUPAC Name | 1,5-bis(trimethoxysilyl)pentan-3-amine |
| SMILES | CO[Si](CCC(N)CC[Si](OC)(OC)OC)(OC)OC |
| InChI | InChI=1S/C11H29NO6Si2/c1-13-19(14-2,15-3)9-7-11(12)8-10-20(16-4,17-5)18-6/h11H,7-10,12H2,1-6H3 |
| InChIKey | ZYMRSMXUVIKGTJ-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 81.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.53 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|