C14H36N2O6Si2 — CID 57029504
1,8-bis(trimethoxysilyl)octane-4,5-diamine (PubChem CID 57029504) has the molecular formula C14H36N2O6Si2 and a molecular weight of 384.62 g/mol. Its IUPAC name is 1,8-bis(trimethoxysilyl)octane-4,5-diamine.
| Compound Name | 1,8-bis(trimethoxysilyl)octane-4,5-diamine |
|---|---|
| PubChem CID | 57029504 |
| Molecular Formula | C14H36N2O6Si2 |
| Molecular Weight | 384.62 g/mol |
| Exact Mass | 384.21 |
| IUPAC Name | 1,8-bis(trimethoxysilyl)octane-4,5-diamine |
| SMILES | CO[Si](CCCC(N)C(N)CCC[Si](OC)(OC)OC)(OC)OC |
| InChI | InChI=1S/C14H36N2O6Si2/c1-17-23(18-2,19-3)11-7-9-13(15)14(16)10-8-12-24(20-4,21-5)22-6/h13-14H,7-12,15-16H2,1-6H3 |
| InChIKey | IIPWXHLGZIOYLM-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 107.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.62 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|