C43H104O19Si8 — CID 176610404
1,7-bis[tris(3-trimethoxysilylpropyl)silyl]heptan-4-ol (PubChem CID 176610404) has the molecular formula C43H104O19Si8 and a molecular weight of 1149.97 g/mol. Its IUPAC name is 1,7-bis[tris(3-trimethoxysilylpropyl)silyl]heptan-4-ol.
| Compound Name | 1,7-bis[tris(3-trimethoxysilylpropyl)silyl]heptan-4-ol |
|---|---|
| PubChem CID | 176610404 |
| Molecular Formula | C43H104O19Si8 |
| Molecular Weight | 1149.97 g/mol |
| Exact Mass | 1148.53 |
| IUPAC Name | 1,7-bis[tris(3-trimethoxysilylpropyl)silyl]heptan-4-ol |
| SMILES | CO[Si](CCC[Si](CCCC(O)CCC[Si](CCC[Si](OC)(OC)OC)(CCC[Si](OC)(OC)OC)CCC[Si](OC)(OC)OC)(CCC[Si](OC)(OC)OC)CCC[Si](OC)(OC)OC)(OC)OC |
| InChI | InChI=1S/C43H104O19Si8/c1-45-65(46-2,47-3)37-21-31-63(32-22-38-66(48-4,49-5)50-6,33-23-39-67(51-7,52-8)53-9)29-19-27-43(44)28-20-30-64(34-24-40-68(54-10,55-11)56-12,35-25-41-69(57-13,58-14)59-15)36-26-42-70(60-16,61-17)62-18/h43-44H,19-42H2,1-18H3 |
| InChIKey | DASWZWWWHVSALD-UHFFFAOYSA-N |
| XLogP | 8.41 |
| TPSA | 186.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 19 |
| Rotatable Bonds | 50 |
| Heavy Atoms | 70 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1149.97 |
| LogP ≤ 5 | 8.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 19 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|