C67H158O28Si12 — CID 160918976
7-[tris(3-trimethoxysilylpropyl)silyl]-4,4-bis[3-[tris(3-trimethoxysilylpropyl)silyl]propyl]heptan-2-one (PubChem CID 160918976) has the molecular formula C67H158O28Si12 and a molecular weight of 1749.00 g/mol. Its IUPAC name is 7-[tris(3-trimethoxysilylpropyl)silyl]-4,4-bis[3-[tris(3-trimethoxysilylpropyl)silyl]propyl]heptan-2-one.
| Compound Name | 7-[tris(3-trimethoxysilylpropyl)silyl]-4,4-bis[3-[tris(3-trimethoxysilylpropyl)silyl]propyl]heptan-2-one |
|---|---|
| PubChem CID | 160918976 |
| Molecular Formula | C67H158O28Si12 |
| Molecular Weight | 1749.00 g/mol |
| Exact Mass | 1746.82 |
| IUPAC Name | 7-[tris(3-trimethoxysilylpropyl)silyl]-4,4-bis[3-[tris(3-trimethoxysilylpropyl)silyl]propyl]heptan-2-one |
| SMILES | CO[Si](CCC[Si](CCCC(CCC[Si](CCC[Si](OC)(OC)OC)(CCC[Si](OC)(OC)OC)CCC[Si](OC)(OC)OC)(CCC[Si](CCC[Si](OC)(OC)OC)(CCC[Si](OC)(OC)OC)CCC[Si](OC)(OC)OC)CC(C)=O)(CCC[Si](OC)(OC)OC)CCC[Si](OC)(OC)OC)(OC)OC |
| InChI | InChI=1S/C67H158O28Si12/c1-66(68)65-67(41-29-44-96(47-32-56-99(69-2,70-3)71-4,48-33-57-100(72-5,73-6)74-7)49-34-58-101(75-8,76-9)77-10,42-30-45-97(50-35-59-102(78-11,79-12)80-13,51-36-60-103(81-14,82-15)83-16)52-37-61-104(84-17,85-18)86-19)43-31-46-98(53-38-62-105(87-20,88-21)89-22,54-39-63-106(90-23,91-24)92-25)55-40-64-107(93-26,94-27)95-28/h29-65H2,1-28H3 |
| InChIKey | LAAPXBNZZMNCAH-UHFFFAOYSA-N |
| XLogP | 14.05 |
| TPSA | 266.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 28 |
| Rotatable Bonds | 77 |
| Heavy Atoms | 107 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1749.00 |
| LogP ≤ 5 | 14.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 28 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|