C65H156O28Si12 — CID 160847650
trimethoxy-[3-[3-[4-methyl-1,7-bis[tris(3-trimethoxysilylpropyl)silyl]heptan-4-yl]oxypropyl-bis(3-trimethoxysilylpropyl)silyl]propyl]silane (PubChem CID 160847650) has the molecular formula C65H156O28Si12 and a molecular weight of 1722.97 g/mol. Its IUPAC name is trimethoxy-[3-[3-[4-methyl-1,7-bis[tris(3-trimethoxysilylpropyl)silyl]heptan-4-yl]oxypropyl-bis(3-trimethoxysilylpropyl)silyl]propyl]silane.
| Compound Name | trimethoxy-[3-[3-[4-methyl-1,7-bis[tris(3-trimethoxysilylpropyl)silyl]heptan-4-yl]oxypropyl-bis(3-trimethoxysilylpropyl)silyl]propyl]silane |
|---|---|
| PubChem CID | 160847650 |
| Molecular Formula | C65H156O28Si12 |
| Molecular Weight | 1722.97 g/mol |
| Exact Mass | 1720.80 |
| IUPAC Name | trimethoxy-[3-[3-[4-methyl-1,7-bis[tris(3-trimethoxysilylpropyl)silyl]heptan-4-yl]oxypropyl-bis(3-trimethoxysilylpropyl)silyl]propyl]silane |
| SMILES | CO[Si](CCC[Si](CCCOC(C)(CCC[Si](CCC[Si](OC)(OC)OC)(CCC[Si](OC)(OC)OC)CCC[Si](OC)(OC)OC)CCC[Si](CCC[Si](OC)(OC)OC)(CCC[Si](OC)(OC)OC)CCC[Si](OC)(OC)OC)(CCC[Si](OC)(OC)OC)CCC[Si](OC)(OC)OC)(OC)OC |
| InChI | InChI=1S/C65H156O28Si12/c1-65(41-29-44-94(47-32-56-97(66-2,67-3)68-4,48-33-57-98(69-5,70-6)71-7)49-34-58-99(72-8,73-9)74-10,42-30-45-95(50-35-59-100(75-11,76-12)77-13,51-36-60-101(78-14,79-15)80-16)52-37-61-102(81-17,82-18)83-19)93-43-31-46-96(53-38-62-103(84-20,85-21)86-22,54-39-63-104(87-23,88-24)89-25)55-40-64-105(90-26,91-27)92-28/h29-64H2,1-28H3 |
| InChIKey | ZEJLXQNYWBXWPX-UHFFFAOYSA-N |
| XLogP | 13.47 |
| TPSA | 258.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 28 |
| Rotatable Bonds | 76 |
| Heavy Atoms | 105 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1722.97 |
| LogP ≤ 5 | 13.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 28 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|