C13H30O3Si — CID 140817013
7,7-dimethyloctyl(trimethoxy)silane (PubChem CID 140817013) has the molecular formula C13H30O3Si and a molecular weight of 262.47 g/mol. Its IUPAC name is 7,7-dimethyloctyl(trimethoxy)silane.
| Compound Name | 7,7-dimethyloctyl(trimethoxy)silane |
|---|---|
| PubChem CID | 140817013 |
| Molecular Formula | C13H30O3Si |
| Molecular Weight | 262.47 g/mol |
| Exact Mass | 262.20 |
| IUPAC Name | 7,7-dimethyloctyl(trimethoxy)silane |
| SMILES | CO[Si](CCCCCCC(C)(C)C)(OC)OC |
| InChI | InChI=1S/C13H30O3Si/c1-13(2,3)11-9-7-8-10-12-17(14-4,15-5)16-6/h7-12H2,1-6H3 |
| InChIKey | WRQRIGQYVUCDIC-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.47 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|