C9H15F7O4Si — CID 2733757
3-(1,1,2,2,3,3,3-heptafluoropropoxy)propyl-trimethoxysilane (PubChem CID 2733757) has the molecular formula C9H15F7O4Si and a molecular weight of 348.29 g/mol. Its IUPAC name is 3-(1,1,2,2,3,3,3-heptafluoropropoxy)propyl-trimethoxysilane.
| Compound Name | 3-(1,1,2,2,3,3,3-heptafluoropropoxy)propyl-trimethoxysilane |
|---|---|
| PubChem CID | 2733757 |
| Molecular Formula | C9H15F7O4Si |
| Molecular Weight | 348.29 g/mol |
| Exact Mass | 348.06 |
| IUPAC Name | 3-(1,1,2,2,3,3,3-heptafluoropropoxy)propyl-trimethoxysilane |
| SMILES | CO[Si](CCCOC(F)(F)C(F)(F)C(F)(F)F)(OC)OC |
| InChI | InChI=1S/C9H15F7O4Si/c1-17-21(18-2,19-3)6-4-5-20-9(15,16)7(10,11)8(12,13)14/h4-6H2,1-3H3 |
| InChIKey | WTRLQPBTOQFOEJ-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.29 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|