C30H46F24O6Si4 — CID 173326671
bis[[dimethyl-[3-(1,1,2,2,3,3,4,4-octafluoropentoxy)propyl]silyl]oxy]silyloxy-dimethyl-[3-(1,1,2,2,3,3,4,4-octafluoropentoxy)propyl]silane (PubChem CID 173326671) has the molecular formula C30H46F24O6Si4 and a molecular weight of 1070.99 g/mol. Its IUPAC name is bis[[dimethyl-[3-(1,1,2,2,3,3,4,4-octafluoropentoxy)propyl]silyl]oxy]silyloxy-dimethyl-[3-(1,1,2,2,3,3,4,4-octafluoropentoxy)propyl]silane.
| Compound Name | bis[[dimethyl-[3-(1,1,2,2,3,3,4,4-octafluoropentoxy)propyl]silyl]oxy]silyloxy-dimethyl-[3-(1,1,2,2,3,3,4,4-octafluoropentoxy)propyl]silane |
|---|---|
| PubChem CID | 173326671 |
| Molecular Formula | C30H46F24O6Si4 |
| Molecular Weight | 1070.99 g/mol |
| Exact Mass | 1070.20 |
| IUPAC Name | bis[[dimethyl-[3-(1,1,2,2,3,3,4,4-octafluoropentoxy)propyl]silyl]oxy]silyloxy-dimethyl-[3-(1,1,2,2,3,3,4,4-octafluoropentoxy)propyl]silane |
| SMILES | CC(F)(F)C(F)(F)C(F)(F)C(F)(F)OCCC[Si](C)(C)O[SiH](O[Si](C)(C)CCCOC(F)(F)C(F)(F)C(F)(F)C(C)(F)F)O[Si](C)(C)CCCOC(F)(F)C(F)(F)C(F)(F)C(C)(F)F |
| InChI | InChI=1S/C30H46F24O6Si4/c1-19(31,32)22(37,38)25(43,44)28(49,50)55-13-10-16-62(4,5)58-61(59-63(6,7)17-11-14-56-29(51,52)26(45,46)23(39,40)20(2,33)34)60-64(8,9)18-12-15-57-30(53,54)27(47,48)24(41,42)21(3,35)36/h61H,10-18H2,1-9H3 |
| InChIKey | AXXSMPRMAZYATG-UHFFFAOYSA-N |
| XLogP | 13.14 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1070.99 |
| LogP ≤ 5 | 13.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|