C17H44O2Si4 — CID 123418519
tert-butyl-[3-[2-[dimethylsilyloxy(dimethyl)silyl]ethyl-dimethylsilyl]propoxy]-dimethylsilane (PubChem CID 123418519) has the molecular formula C17H44O2Si4 and a molecular weight of 392.88 g/mol. Its IUPAC name is tert-butyl-[3-[2-[dimethylsilyloxy(dimethyl)silyl]ethyl-dimethylsilyl]propoxy]-dimethylsilane.
| Compound Name | tert-butyl-[3-[2-[dimethylsilyloxy(dimethyl)silyl]ethyl-dimethylsilyl]propoxy]-dimethylsilane |
|---|---|
| PubChem CID | 123418519 |
| Molecular Formula | C17H44O2Si4 |
| Molecular Weight | 392.88 g/mol |
| Exact Mass | 392.24 |
| IUPAC Name | tert-butyl-[3-[2-[dimethylsilyloxy(dimethyl)silyl]ethyl-dimethylsilyl]propoxy]-dimethylsilane |
| SMILES | C[SiH](C)O[Si](C)(C)CC[Si](C)(C)CCCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C17H44O2Si4/c1-17(2,3)23(10,11)18-13-12-14-21(6,7)15-16-22(8,9)19-20(4)5/h20H,12-16H2,1-11H3 |
| InChIKey | KDOJNUALCSGFSB-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.88 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|