C13H30OSi — CID 59819312
tert-butyl-(4,4-dimethylpentoxy)-dimethylsilane (PubChem CID 59819312) has the molecular formula C13H30OSi and a molecular weight of 230.47 g/mol. Its IUPAC name is tert-butyl-(4,4-dimethylpentoxy)-dimethylsilane.
| Compound Name | tert-butyl-(4,4-dimethylpentoxy)-dimethylsilane |
|---|---|
| PubChem CID | 59819312 |
| Molecular Formula | C13H30OSi |
| Molecular Weight | 230.47 g/mol |
| Exact Mass | 230.21 |
| IUPAC Name | tert-butyl-(4,4-dimethylpentoxy)-dimethylsilane |
| SMILES | CC(C)(C)CCCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C13H30OSi/c1-12(2,3)10-9-11-14-15(7,8)13(4,5)6/h9-11H2,1-8H3 |
| InChIKey | TUOKADXSMXOCPI-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.47 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|