C29H64NO3Si2UV- — CID 153487293
[11-[tert-butyl(dimethyl)silyl]oxy-5-[6-[tert-butyl(dimethyl)silyl]oxyhexyl]-5-hydroxyundecyl]azanide;uranium;vanadium (PubChem CID 153487293) has the molecular formula C29H64NO3Si2UV- and a molecular weight of 819.98 g/mol. Its IUPAC name is [11-[tert-butyl(dimethyl)silyl]oxy-5-[6-[tert-butyl(dimethyl)silyl]oxyhexyl]-5-hydroxyundecyl]azanide;uranium;vanadium.
| Compound Name | [11-[tert-butyl(dimethyl)silyl]oxy-5-[6-[tert-butyl(dimethyl)silyl]oxyhexyl]-5-hydroxyundecyl]azanide;uranium;vanadium |
|---|---|
| PubChem CID | 153487293 |
| Molecular Formula | C29H64NO3Si2UV- |
| Molecular Weight | 819.98 g/mol |
| Exact Mass | 819.44 |
| IUPAC Name | [11-[tert-butyl(dimethyl)silyl]oxy-5-[6-[tert-butyl(dimethyl)silyl]oxyhexyl]-5-hydroxyundecyl]azanide;uranium;vanadium |
| SMILES | CC(C)(C)[Si](C)(C)OCCCCCCC(O)(CCCC[NH-])CCCCCCO[Si](C)(C)C(C)(C)C.[U].[V] |
| InChI | InChI=1S/C29H64NO3Si2.U.V/c1-27(2,3)34(7,8)32-25-19-13-11-15-21-29(31,23-17-18-24-30)22-16-12-14-20-26-33-35(9,10)28(4,5)6;;/h30-31H,11-26H2,1-10H3;;/q-1;; |
| InChIKey | DRYLUPLFIVUNAL-UHFFFAOYSA-N |
| XLogP | 9.88 |
| TPSA | 62.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 819.98 |
| LogP ≤ 5 | 9.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|