C16H36O2Si — CID 102212924
10-[tert-butyl(dimethyl)silyl]oxy-1,1-dideuteriodecan-1-ol (PubChem CID 102212924) has the molecular formula C16H36O2Si and a molecular weight of 290.56 g/mol. Its IUPAC name is 10-[tert-butyl(dimethyl)silyl]oxy-1,1-dideuteriodecan-1-ol.
| Compound Name | 10-[tert-butyl(dimethyl)silyl]oxy-1,1-dideuteriodecan-1-ol |
|---|---|
| PubChem CID | 102212924 |
| Molecular Formula | C16H36O2Si |
| Molecular Weight | 290.56 g/mol |
| Exact Mass | 290.26 |
| IUPAC Name | 10-[tert-butyl(dimethyl)silyl]oxy-1,1-dideuteriodecan-1-ol |
| SMILES | [2H]C([2H])(O)CCCCCCCCCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C16H36O2Si/c1-16(2,3)19(4,5)18-15-13-11-9-7-6-8-10-12-14-17/h17H,6-15H2,1-5H3/i14D2 |
| InChIKey | DBFKYLCYAQNIQL-FNHLFAINSA-N |
| XLogP | 5.12 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.56 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|