C15H34OSi — CID 10753997
tert-butyl-dimethyl-(3,3,4,4-tetradeuteriononoxy)silane (PubChem CID 10753997) has the molecular formula C15H34OSi and a molecular weight of 262.55 g/mol. Its IUPAC name is tert-butyl-dimethyl-(3,3,4,4-tetradeuteriononoxy)silane.
| Compound Name | tert-butyl-dimethyl-(3,3,4,4-tetradeuteriononoxy)silane |
|---|---|
| PubChem CID | 10753997 |
| Molecular Formula | C15H34OSi |
| Molecular Weight | 262.55 g/mol |
| Exact Mass | 262.26 |
| IUPAC Name | tert-butyl-dimethyl-(3,3,4,4-tetradeuteriononoxy)silane |
| SMILES | [2H]C([2H])(CCCCC)C([2H])([2H])CCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C15H34OSi/c1-7-8-9-10-11-12-13-14-16-17(5,6)15(2,3)4/h7-14H2,1-6H3/i11D2,12D2 |
| InChIKey | HEIZMMGMWPKPPU-AREBVXNXSA-N |
| XLogP | 5.76 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.55 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|