C23H52O2Si2 — CID 10862726
(3R,4R)-14-[tert-butyl(dimethyl)silyl]oxy-9,9,10,10-tetradeuterio-4-trimethylsilyltetradecan-3-ol (PubChem CID 10862726) has the molecular formula C23H52O2Si2 and a molecular weight of 420.86 g/mol. Its IUPAC name is (3R,4R)-14-[tert-butyl(dimethyl)silyl]oxy-9,9,10,10-tetradeuterio-4-trimethylsilyltetradecan-3-ol.
| Compound Name | (3R,4R)-14-[tert-butyl(dimethyl)silyl]oxy-9,9,10,10-tetradeuterio-4-trimethylsilyltetradecan-3-ol |
|---|---|
| PubChem CID | 10862726 |
| Molecular Formula | C23H52O2Si2 |
| Molecular Weight | 420.86 g/mol |
| Exact Mass | 420.38 |
| IUPAC Name | (3R,4R)-14-[tert-butyl(dimethyl)silyl]oxy-9,9,10,10-tetradeuterio-4-trimethylsilyltetradecan-3-ol |
| SMILES | [2H]C([2H])(CCCCO[Si](C)(C)C(C)(C)C)C([2H])([2H])CCCC[C@H]([C@H](O)CC)[Si](C)(C)C |
| InChI | InChI=1S/C23H52O2Si2/c1-10-21(24)22(26(5,6)7)19-17-15-13-11-12-14-16-18-20-25-27(8,9)23(2,3)4/h21-22,24H,10-20H2,1-9H3/t21-,22-/m1/s1/i11D2,12D2 |
| InChIKey | ZGONPIKLWQNLAE-IIMUTNRESA-N |
| XLogP | 8.00 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.86 |
| LogP ≤ 5 | 8.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|