C13H30O3Si — CID 15605935
(3R)-7-[tert-butyl(dimethyl)silyl]oxyheptane-1,3-diol (PubChem CID 15605935) has the molecular formula C13H30O3Si and a molecular weight of 262.47 g/mol. Its IUPAC name is (3R)-7-[tert-butyl(dimethyl)silyl]oxyheptane-1,3-diol.
| Compound Name | (3R)-7-[tert-butyl(dimethyl)silyl]oxyheptane-1,3-diol |
|---|---|
| PubChem CID | 15605935 |
| Molecular Formula | C13H30O3Si |
| Molecular Weight | 262.47 g/mol |
| Exact Mass | 262.20 |
| IUPAC Name | (3R)-7-[tert-butyl(dimethyl)silyl]oxyheptane-1,3-diol |
| SMILES | CC(C)(C)[Si](C)(C)OCCCC[C@@H](O)CCO |
| InChI | InChI=1S/C13H30O3Si/c1-13(2,3)17(4,5)16-11-7-6-8-12(15)9-10-14/h12,14-15H,6-11H2,1-5H3/t12-/m1/s1 |
| InChIKey | SGLUIJXFDZYDGS-GFCCVEGCSA-N |
| XLogP | 2.92 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.47 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|