C14H32O4Si — CID 71376160
acetic acid;6-[tert-butyl(dimethyl)silyl]oxyhexan-1-ol (PubChem CID 71376160) has the molecular formula C14H32O4Si and a molecular weight of 292.49 g/mol. Its IUPAC name is acetic acid;6-[tert-butyl(dimethyl)silyl]oxyhexan-1-ol.
| Compound Name | acetic acid;6-[tert-butyl(dimethyl)silyl]oxyhexan-1-ol |
|---|---|
| PubChem CID | 71376160 |
| Molecular Formula | C14H32O4Si |
| Molecular Weight | 292.49 g/mol |
| Exact Mass | 292.21 |
| IUPAC Name | acetic acid;6-[tert-butyl(dimethyl)silyl]oxyhexan-1-ol |
| SMILES | CC(=O)O.CC(C)(C)[Si](C)(C)OCCCCCCO |
| InChI | InChI=1S/C12H28O2Si.C2H4O2/c1-12(2,3)15(4,5)14-11-9-7-6-8-10-13;1-2(3)4/h13H,6-11H2,1-5H3;1H3,(H,3,4) |
| InChIKey | VXFGPCKUUPTAFY-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.49 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|