About tert-butyl-hex-5-ynoxy-dimethylsilane;hex-5-yn-1-ol
tert-butyl-hex-5-ynoxy-dimethylsilane;hex-5-yn-1-ol (PubChem CID 158514976) has the molecular formula C18H34O2Si
and a molecular weight of 310.55 g/mol. Its IUPAC name is tert-butyl-hex-5-ynoxy-dimethylsilane;hex-5-yn-1-ol.
Molecular Properties
| Compound Name | tert-butyl-hex-5-ynoxy-dimethylsilane;hex-5-yn-1-ol |
| PubChem CID | 158514976 |
| Molecular Formula | C18H34O2Si |
| Molecular Weight | 310.55 g/mol |
| Exact Mass | 310.23 |
| IUPAC Name | tert-butyl-hex-5-ynoxy-dimethylsilane;hex-5-yn-1-ol |
| SMILES | C#CCCCCO.C#CCCCCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C12H24OSi.C6H10O/c1-7-8-9-10-11-13-14(5,6)12(2,3)4;1-2-3-4-5-6-7/h1H,8-11H2,2-6H3;1,7H,3-6H2 |
| InChIKey | HLNBMJJTZITHPZ-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.55 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl-hex-5-ynoxy-dimethylsilane;hex-5-yn-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl-hex-5-ynoxy-dimethylsilane;hex-5-yn-1-ol?
The IUPAC name of tert-butyl-hex-5-ynoxy-dimethylsilane;hex-5-yn-1-ol (CID 158514976) is tert-butyl-hex-5-ynoxy-dimethylsilane;hex-5-yn-1-ol.
What is the SMILES notation for tert-butyl-hex-5-ynoxy-dimethylsilane;hex-5-yn-1-ol?
The canonical SMILES for tert-butyl-hex-5-ynoxy-dimethylsilane;hex-5-yn-1-ol is C#CCCCCO.C#CCCCCO[Si](C)(C)C(C)(C)C.
What is the InChIKey of tert-butyl-hex-5-ynoxy-dimethylsilane;hex-5-yn-1-ol?
The InChIKey is HLNBMJJTZITHPZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24OSi.C6H10O/c1-7-8-9-10-11-13-14(5,6)12(2,3)4;1-2-3-4-5-6-7/h1H,8-11H2,2-6H3;1,7H,3-6H2.
What are the key properties of tert-butyl-hex-5-ynoxy-dimethylsilane;hex-5-yn-1-ol?
tert-butyl-hex-5-ynoxy-dimethylsilane;hex-5-yn-1-ol has a molecular weight of 310.55 g/mol, XLogP of 4.59, 8 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl-hex-5-ynoxy-dimethylsilane;hex-5-yn-1-ol is sourced from PubChem (CID 158514976), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).