C17H34O4Si — CID 123934980
2-acetyl-8-[tert-butyl(dimethyl)silyl]oxy-2-methyloctanoic acid (PubChem CID 123934980) has the molecular formula C17H34O4Si and a molecular weight of 330.54 g/mol. Its IUPAC name is 2-acetyl-8-[tert-butyl(dimethyl)silyl]oxy-2-methyloctanoic acid.
| Compound Name | 2-acetyl-8-[tert-butyl(dimethyl)silyl]oxy-2-methyloctanoic acid |
|---|---|
| PubChem CID | 123934980 |
| Molecular Formula | C17H34O4Si |
| Molecular Weight | 330.54 g/mol |
| Exact Mass | 330.22 |
| IUPAC Name | 2-acetyl-8-[tert-butyl(dimethyl)silyl]oxy-2-methyloctanoic acid |
| SMILES | CC(=O)C(C)(CCCCCCO[Si](C)(C)C(C)(C)C)C(=O)O |
| InChI | InChI=1S/C17H34O4Si/c1-14(18)17(5,15(19)20)12-10-8-9-11-13-21-22(6,7)16(2,3)4/h8-13H2,1-7H3,(H,19,20) |
| InChIKey | WIIMVFQPSDVIPC-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.54 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|