C21H42O4Si — CID 168962220
15-[tert-butyl(dimethyl)silyl]oxy-9-oxopentadecanoic acid (PubChem CID 168962220) has the molecular formula C21H42O4Si and a molecular weight of 386.65 g/mol. Its IUPAC name is 15-[tert-butyl(dimethyl)silyl]oxy-9-oxopentadecanoic acid.
| Compound Name | 15-[tert-butyl(dimethyl)silyl]oxy-9-oxopentadecanoic acid |
|---|---|
| PubChem CID | 168962220 |
| Molecular Formula | C21H42O4Si |
| Molecular Weight | 386.65 g/mol |
| Exact Mass | 386.29 |
| IUPAC Name | 15-[tert-butyl(dimethyl)silyl]oxy-9-oxopentadecanoic acid |
| SMILES | CC(C)(C)[Si](C)(C)OCCCCCCC(=O)CCCCCCCC(=O)O |
| InChI | InChI=1S/C21H42O4Si/c1-21(2,3)26(4,5)25-18-14-10-9-12-16-19(22)15-11-7-6-8-13-17-20(23)24/h6-18H2,1-5H3,(H,23,24) |
| InChIKey | JDKUQLISVNLHDF-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.65 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|