C23H47NO5Si — CID 10718218
10-[2-[tert-butyl(dimethyl)silyl]oxyethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]decanoic acid (PubChem CID 10718218) has the molecular formula C23H47NO5Si and a molecular weight of 445.72 g/mol. Its IUPAC name is 10-[2-[tert-butyl(dimethyl)silyl]oxyethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]decanoic acid.
| Compound Name | 10-[2-[tert-butyl(dimethyl)silyl]oxyethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]decanoic acid |
|---|---|
| PubChem CID | 10718218 |
| Molecular Formula | C23H47NO5Si |
| Molecular Weight | 445.72 g/mol |
| Exact Mass | 445.32 |
| IUPAC Name | 10-[2-[tert-butyl(dimethyl)silyl]oxyethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]decanoic acid |
| SMILES | CC(C)(C)OC(=O)N(CCCCCCCCCC(=O)O)CCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C23H47NO5Si/c1-22(2,3)29-21(27)24(18-19-28-30(7,8)23(4,5)6)17-15-13-11-9-10-12-14-16-20(25)26/h9-19H2,1-8H3,(H,25,26) |
| InChIKey | JWMCSWNJUSNWDV-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.72 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|