C19H43NO4Si2 — CID 164815617
3-[bis[2-[tert-butyl(dimethyl)silyl]oxyethyl]amino]propanoic acid (PubChem CID 164815617) has the molecular formula C19H43NO4Si2 and a molecular weight of 405.73 g/mol. Its IUPAC name is 3-[bis[2-[tert-butyl(dimethyl)silyl]oxyethyl]amino]propanoic acid.
| Compound Name | 3-[bis[2-[tert-butyl(dimethyl)silyl]oxyethyl]amino]propanoic acid |
|---|---|
| PubChem CID | 164815617 |
| Molecular Formula | C19H43NO4Si2 |
| Molecular Weight | 405.73 g/mol |
| Exact Mass | 405.27 |
| IUPAC Name | 3-[bis[2-[tert-butyl(dimethyl)silyl]oxyethyl]amino]propanoic acid |
| SMILES | CC(C)(C)[Si](C)(C)OCCN(CCO[Si](C)(C)C(C)(C)C)CCC(=O)O |
| InChI | InChI=1S/C19H43NO4Si2/c1-18(2,3)25(7,8)23-15-13-20(12-11-17(21)22)14-16-24-26(9,10)19(4,5)6/h11-16H2,1-10H3,(H,21,22) |
| InChIKey | RPHCKHLHZUSGQH-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.73 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|