C18H41NO4Si2 — CID 18751403
2-[bis[2-[tert-butyl(dimethyl)silyl]oxyethyl]amino]acetic acid (PubChem CID 18751403) has the molecular formula C18H41NO4Si2 and a molecular weight of 391.70 g/mol. Its IUPAC name is 2-[bis[2-[tert-butyl(dimethyl)silyl]oxyethyl]amino]acetic acid.
| Compound Name | 2-[bis[2-[tert-butyl(dimethyl)silyl]oxyethyl]amino]acetic acid |
|---|---|
| PubChem CID | 18751403 |
| Molecular Formula | C18H41NO4Si2 |
| Molecular Weight | 391.70 g/mol |
| Exact Mass | 391.26 |
| IUPAC Name | 2-[bis[2-[tert-butyl(dimethyl)silyl]oxyethyl]amino]acetic acid |
| SMILES | CC(C)(C)[Si](C)(C)OCCN(CCO[Si](C)(C)C(C)(C)C)CC(=O)O |
| InChI | InChI=1S/C18H41NO4Si2/c1-17(2,3)24(7,8)22-13-11-19(15-16(20)21)12-14-23-25(9,10)18(4,5)6/h11-15H2,1-10H3,(H,20,21) |
| InChIKey | MRRHBZXKJGGCLT-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.70 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|