C27H33NO3Si — CID 67674409
2-[benzyl-[2-[tert-butyl(diphenyl)silyl]oxyethyl]amino]acetic acid (PubChem CID 67674409) has the molecular formula C27H33NO3Si and a molecular weight of 447.65 g/mol. Its IUPAC name is 2-[benzyl-[2-[tert-butyl(diphenyl)silyl]oxyethyl]amino]acetic acid.
| Compound Name | 2-[benzyl-[2-[tert-butyl(diphenyl)silyl]oxyethyl]amino]acetic acid |
|---|---|
| PubChem CID | 67674409 |
| Molecular Formula | C27H33NO3Si |
| Molecular Weight | 447.65 g/mol |
| Exact Mass | 447.22 |
| IUPAC Name | 2-[benzyl-[2-[tert-butyl(diphenyl)silyl]oxyethyl]amino]acetic acid |
| SMILES | CC(C)(C)[Si](OCCN(CC(=O)O)Cc1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H33NO3Si/c1-27(2,3)32(24-15-9-5-10-16-24,25-17-11-6-12-18-25)31-20-19-28(22-26(29)30)21-23-13-7-4-8-14-23/h4-18H,19-22H2,1-3H3,(H,29,30) |
| InChIKey | LDFIFIJUIQLHRN-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.65 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|